BIOCHEMISTRY

download report

Transcript BIOCHEMISTRY

Biochemistry Jeopardy
Hydro- Carbos Lipids Procarbons
teins
10
10
10
10
Nucl.
acids
10
20
20
20
20
20
20
30
30
30
30
30
30
40
40
40
40
40
40
50
50
50
50
50
50
Cinda Sheldon
Misc.
10
Hydrocarbons $10
How many bonds can a
carbon atom form with
other atoms?
4
Cinda Sheldon
Hydrocarbons $20
What are compounds with the
same molecular formula, but
arranged differently in their
structures?
isomers
Cinda Sheldon
Hydrocarbons $30
What is the removing of water to
join monomers called?
What is the addition of water to
split polymers called?
Dehydration synthesis
Hydrolysis
Cinda Sheldon
Hydrocarbons $40
Match the functional groups:
-COOH
A. hydroxyl
-NH2
B. carboxyl
-C=O
C. carbonyl
-OH
D. amino
B , D, C, A
Cinda Sheldon
Hydrocarbons $50
Identify the triglyceride, disaccharide,
amino acid and the nucleotide.
Cinda Sheldon
Carbohydrates $10
What is the monomer of a
carbohydrate called?
monosaccharide
Cinda Sheldon
Carbohydrates $20
Most sugars end in which
suffix?
Give two examples:
-ose
-glucose, sucrose, fructose,
maltose
Cinda Sheldon
Carbohydrates $30
Describe the test used to
determine positive results for
glucose and what the results
would look like:
Benedicts heated turns blue to
orange-red
Cinda Sheldon
Carbohydrates $40
Describe the positive test for
starch: what is used and what a
positive test looks like.
Starch turns iodine from straw
yellow to blue-black
Cinda Sheldon
Carbohydrates $50
MATCH:
1. Cellulose A. polysacch. - plants
2. Glucose
B. fiber from plants
3. Glycogen
C. polysacch. - animals
4. Starch
D. monosaccharide
5. Sucrose
E. disaccharide
1-B 2-D 3-C 4-A 5-E
Cinda Sheldon
Lipids $10
Which best describes lipids?
A. hydrophilic
B. hydrophobic
C. ionic
D. polar covalent
B “water fearing”
Cinda Sheldon
Lipids $20
What is the monomer of
lipids?
Fatty acids and glycerol
Cinda Sheldon
Lipids $30
A triglyceride has how many
glycerols and how many fatty
acids?
1 glycerol (backbone)
3 fatty acids
Cinda Sheldon
Lipids $40
What kind
of molecules
are these
lipids?
steroids
Cinda Sheldon
Lipids $50
MATCH
A. Monounsaturated
B. Polyunsaturated
C. Saturated
CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH
Cinda Sheldon
Proteins $10
What is the monomer of
proteins?
Amino acids
Cinda Sheldon
Proteins $20
How many different amino acids
are there?
How are they different?
20
Cinda Sheldon
R groups
Protein $30
What does “denaturation”
mean? What is a positive test
for proteins in the lab?
Unravel proteins
Biurets turns from blue to
purple
Cinda Sheldon
Protein $40
Describe how each level of
proteins are different:
Cinda Sheldon
Protein $50
List and describe the seven
types of proteins:
Structural, storage, signal
hormone, contractile,
defensive, enzyme,
transport
Cinda Sheldon
Nucleic Acids $10
What is the monomer called of
nucleic acids?
nucleotide
Cinda Sheldon
Nucleic Acids $20
What is the name of the element
found in nucleic acids that is
not found in the other
macromolecules?
P or phosphorus
Cinda Sheldon
Nucleic Acids $30
What is the main job of nucleic
acids?
Store genetic information
Cinda Sheldon
Nucleic Acids $40
List two examples of nucleic
acids:
DNA
RNA
Cinda Sheldon
Nucleic Acids $50
What are the three parts of nucleic
acids?
Sugar
Phosphates
Nitrogenous bases
Cinda Sheldon
MISC. $10
Phospholipids, waxes, and steroids
are all:
A. proteins
C. nucleic acids
B. fats
D. carbohydrates
B. fats
Cinda Sheldon
MISC. $20
Artherosclerosis (hardening of
the arteries) is caused by
what:
Build-up of LDL’s
Cinda Sheldon
Misc. $30
Which is not the same as the other three?
A. protein
B. amino acid chain
C. polyunsaturate
D. polypeptide
polyunsaturate
Cinda Sheldon
Misc. $40
What is the name of the bond that
holds together:
A. proteins
B. nucleic acids
A. Peptide
Cinda Sheldon
B. hydrogen
Misc. $50
What is:
1. shape of DNA
2. name of diff. part of amino acids
3. positive test for fats
A. Helical
B. R group
C. Translucence on brown paper
Cinda Sheldon
BONUS:
Which is a monosaccharide and which is a disaccharide?
Disaccharide
Cinda Sheldon
Monosaccharide
How can you tell fats from
carbos?
n
n
n
Carbos
H:O
2:1
n
n
n
Fats
H:O
Greater than twice
as many H as O
CH3(CH2)10CO2H
CH3(CH2)4(CH=CHCH2)4(CH2)2CO2H
Cinda Sheldon
Where is this polysaccharide
stored?
n
Glycogen
n
Cellulose
n
Starch
Cinda Sheldon
n
Liver and muscles in
animals
Cell walls of plants
Plants (nuts, potatoes,
etc.)
What if starch underwent
hydrolysis, what monomer would
form? What test could you do to
be sure that is what it is?
n
n
Glucose
Benedicts blue to orange-red
Cinda Sheldon
Most common carbohydrate in
the world?
n
A. glucose
B. cellulose
C. starch
D. phospholipid
n
ANSWER: cellulose
n
n
n
Cinda Sheldon
Match the protein structure:
1. Made of 2 or more
polypeptides
B. Coiled or pleated
C. Folded on itself(3-D
globular or fibrous)
4. Sequence of Amino
Acids
Cinda Sheldon
A. Primary
B. Secondary
C. Tertiary
D. Quaternary
ANSWERS:
1-D, 2-B, 3-C, 4-A
What two elements are
hydrocrbons made of?
n
Carbon and hydrogen
Nitrogen and carbon
Oxygen and carbon
Hydrogen and oxygen
n
ANSWER: hydrogen and carbon
n
n
n
Cinda Sheldon